| Name | Triphenylcarbenium hexafluorophosphate |
| Synonyms | Trityl hexafluorophosphate TRITYL HEXAFLUORO-PHOSPHATE Tritylium hexafluorophosphate TRITYLIUM HEXAFLUOROPHOSPHATE Trityl cation·hexafluorophosphate Triphenylcarbenium hexafluorophosphate Triphenylmethylium·hexafluorophosphate TRIPHENYLCARBENIUM HEXAFLUOROPHOSPHATE triphenylmethylium hexafluorophosphate triphenyl-methyliuhexafluorophosphate(1-) Trityl hexafluorophosphate, Tritylium hexafluorophosphate |
| CAS | 437-17-2 |
| EINECS | 207-112-0 |
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| Molecular Formula | C19H15F6P |
| Molar Mass | 388.29 |
| Melting Point | ~150 °C (dec.) (lit.) |
| Water Solubility | Soluble in water. (27 g/L) at 25°C. |
| BRN | 4344297 |
| Storage Condition | 2-8°C |
| Sensitive | Moisture Sensitive |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8-10 |
| TSCA | Yes |
| Hazard Class | 8 |
| Packing Group | II |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |